C14H16F4N6O3S — CID 66615459
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-[3-(methanesulfonamido)propylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 66615459) has the molecular formula C14H16F4N6O3S and a molecular weight of 424.38 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-[3-(methanesulfonamido)propylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-[3-(methanesulfonamido)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 66615459 |
| Molecular Formula | C14H16F4N6O3S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-4-[3-(methanesulfonamido)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)NCCCNc1nonc1/C(N)=N/c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4N6O3S/c1-28(25,26)21-6-2-5-20-13-11(23-27-24-13)12(19)22-8-3-4-10(15)9(7-8)14(16,17)18/h3-4,7,21H,2,5-6H2,1H3,(H2,19,22)(H,20,24) |
| InChIKey | QEHLQTGELRHNOV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|