C18H24F3N5O3S — CID 90910716
N-[3-[[4-[C-butan-2-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]methanesulfonamide (PubChem CID 90910716) has the molecular formula C18H24F3N5O3S and a molecular weight of 447.48 g/mol. Its IUPAC name is N-[3-[[4-[C-butan-2-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[4-[C-butan-2-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 90910716 |
| Molecular Formula | C18H24F3N5O3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[3-[[4-[C-butan-2-yl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]methanesulfonamide |
| SMILES | CCC(C)/C(=N\c1cccc(C(F)(F)F)c1)c1nonc1NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C18H24F3N5O3S/c1-4-12(2)15(24-14-8-5-7-13(11-14)18(19,20)21)16-17(26-29-25-16)22-9-6-10-23-30(3,27)28/h5,7-8,11-12,23H,4,6,9-10H2,1-3H3,(H,22,26)/b24-15+ |
| InChIKey | WUGBPKIZCSIKLQ-BUVRLJJBSA-N |
| XLogP | 3.61 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|