C13H16F3N7O3S — CID 137306200
N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137306200) has the molecular formula C13H16F3N7O3S and a molecular weight of 407.38 g/mol. Its IUPAC name is N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137306200 |
| Molecular Formula | C13H16F3N7O3S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)NCCNc1nonc1/C(=N/c1cccc(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C13H16F3N7O3S/c1-27(17,25)19-6-5-18-11-10(22-26-23-11)12(21-24)20-9-4-2-3-8(7-9)13(14,15)16/h2-4,7,24H,5-6H2,1H3,(H,18,23)(H,20,21)(H2,17,19,25) |
| InChIKey | YRJIRFBYWFPJQQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|