C14H16FN7O3S — CID 137306213
N'-(3-ethynyl-4-fluorophenyl)-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137306213) has the molecular formula C14H16FN7O3S and a molecular weight of 381.39 g/mol. Its IUPAC name is N'-(3-ethynyl-4-fluorophenyl)-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-ethynyl-4-fluorophenyl)-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137306213 |
| Molecular Formula | C14H16FN7O3S |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N'-(3-ethynyl-4-fluorophenyl)-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)NCCNc1nonc1/C(=N/c1ccc(F)c(C#C)c1)NO |
| InChI | InChI=1S/C14H16FN7O3S/c1-3-9-8-10(4-5-11(9)15)19-14(20-23)12-13(22-25-21-12)17-6-7-18-26(2,16)24/h1,4-5,8,23H,6-7H2,2H3,(H,17,22)(H,19,20)(H2,16,18,24) |
| InChIKey | VPHFKHJVHDKNCA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|