C15H17ClFN7O3S — CID 138654093
N'-(3-chloro-4-fluorophenyl)-4-[4-(N-cyano-S-methylsulfonimidoyl)butylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138654093) has the molecular formula C15H17ClFN7O3S and a molecular weight of 429.87 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[4-(N-cyano-S-methylsulfonimidoyl)butylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[4-(N-cyano-S-methylsulfonimidoyl)butylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138654093 |
| Molecular Formula | C15H17ClFN7O3S |
| Molecular Weight | 429.87 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[4-(N-cyano-S-methylsulfonimidoyl)butylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(CCCCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO)=NC#N |
| InChI | InChI=1S/C15H17ClFN7O3S/c1-28(26,20-9-18)7-3-2-6-19-14-13(23-27-24-14)15(22-25)21-10-4-5-12(17)11(16)8-10/h4-5,8,25H,2-3,6-7H2,1H3,(H,19,24)(H,21,22) |
| InChIKey | DUKSQHPSMAHWKR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|