C15H19F3N6O3S — CID 137014402
N-hydroxy-4-[4-(methylsulfonimidoyl)butylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137014402) has the molecular formula C15H19F3N6O3S and a molecular weight of 420.42 g/mol. Its IUPAC name is N-hydroxy-4-[4-(methylsulfonimidoyl)butylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-hydroxy-4-[4-(methylsulfonimidoyl)butylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137014402 |
| Molecular Formula | C15H19F3N6O3S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-hydroxy-4-[4-(methylsulfonimidoyl)butylamino]-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)CCCCNc1nonc1/C(=N/c1cccc(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C15H19F3N6O3S/c1-28(19,26)8-3-2-7-20-13-12(23-27-24-13)14(22-25)21-11-6-4-5-10(9-11)15(16,17)18/h4-6,9,19,25H,2-3,7-8H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | BXCRZECGNHTDMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|