C15H19BrFN7O3S — CID 154975733
N'-(3-bromo-4-fluorophenyl)-4-[3-[(cyclopropylsulfonimidoyl)amino]propylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 154975733) has the molecular formula C15H19BrFN7O3S and a molecular weight of 476.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[3-[(cyclopropylsulfonimidoyl)amino]propylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[3-[(cyclopropylsulfonimidoyl)amino]propylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 154975733 |
| Molecular Formula | C15H19BrFN7O3S |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[3-[(cyclopropylsulfonimidoyl)amino]propylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(=O)(NCCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)C1CC1 |
| InChI | InChI=1S/C15H19BrFN7O3S/c16-11-8-9(2-5-12(11)17)21-15(22-25)13-14(24-27-23-13)19-6-1-7-20-28(18,26)10-3-4-10/h2,5,8,10,25H,1,3-4,6-7H2,(H,19,24)(H,21,22)(H2,18,20,26) |
| InChIKey | DUMQTJHUNLFIKV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|