C16H20BrFN6O3 — CID 156692745
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-morpholin-4-ylpropylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 156692745) has the molecular formula C16H20BrFN6O3 and a molecular weight of 443.28 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-morpholin-4-ylpropylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-morpholin-4-ylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 156692745 |
| Molecular Formula | C16H20BrFN6O3 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-morpholin-4-ylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Br)c1)c1nonc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H20BrFN6O3/c17-12-10-11(2-3-13(12)18)20-16(21-25)14-15(23-27-22-14)19-4-1-5-24-6-8-26-9-7-24/h2-3,10,25H,1,4-9H2,(H,19,23)(H,20,21) |
| InChIKey | NDHXUWFEHXDTSV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|