C18H25BBrFN6O4 — CID 142330607
[1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid;ethane (PubChem CID 142330607) has the molecular formula C18H25BBrFN6O4 and a molecular weight of 499.15 g/mol. Its IUPAC name is [1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid;ethane.
| Compound Name | [1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid;ethane |
|---|---|
| PubChem CID | 142330607 |
| Molecular Formula | C18H25BBrFN6O4 |
| Molecular Weight | 499.15 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]-3,6-dihydro-2H-pyridin-4-yl]boronic acid;ethane |
| SMILES | CC.ON/C(=N\c1ccc(F)c(Br)c1)c1nonc1NCCN1CC=C(B(O)O)CC1 |
| InChI | InChI=1S/C16H19BBrFN6O4.C2H6/c18-12-9-11(1-2-13(12)19)21-16(22-28)14-15(24-29-23-14)20-5-8-25-6-3-10(4-7-25)17(26)27;1-2/h1-3,9,26-28H,4-8H2,(H,20,24)(H,21,22);1-2H3 |
| InChIKey | GPGIOLWHXIIMEB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 139.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|