C14H19BrFN5O3Si — CID 142330513
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-[hydroxy(dimethyl)silyl]propylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142330513) has the molecular formula C14H19BrFN5O3Si and a molecular weight of 432.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-[hydroxy(dimethyl)silyl]propylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-[hydroxy(dimethyl)silyl]propylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142330513 |
| Molecular Formula | C14H19BrFN5O3Si |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-[hydroxy(dimethyl)silyl]propylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | C[Si](C)(O)CCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C14H19BrFN5O3Si/c1-25(2,23)7-3-6-17-13-12(20-24-21-13)14(19-22)18-9-4-5-11(16)10(15)8-9/h4-5,8,22-23H,3,6-7H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | CFVFWZVYWIAHCF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|