C16H14BrFN6O5 — CID 155566545
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155566545) has the molecular formula C16H14BrFN6O5 and a molecular weight of 469.23 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155566545 |
| Molecular Formula | C16H14BrFN6O5 |
| Molecular Weight | 469.23 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COc1c(NCCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)c(=O)c1=O |
| InChI | InChI=1S/C16H14BrFN6O5/c1-28-14-10(12(25)13(14)26)19-4-5-20-15-11(23-29-24-15)16(22-27)21-7-2-3-9(18)8(17)6-7/h2-3,6,19,27H,4-5H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | CQJJCKORCPCRPO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|