C19H22BrFN7O5S2+ — CID 145385734
CID 145385734 (PubChem CID 145385734) has the molecular formula C19H22BrFN7O5S2+ and a molecular weight of 591.47 g/mol.
| Compound Name | CID 145385734 |
|---|---|
| PubChem CID | 145385734 |
| Molecular Formula | C19H22BrFN7O5S2+ |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | — |
| SMILES | Cc1ccc([S+](=O)(O)N=S(C)(=O)NCCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)cc1 |
| InChI | InChI=1S/C19H21BrFN7O5S2/c1-12-3-6-14(7-4-12)35(31,32)28-34(2,30)23-10-9-22-18-17(26-33-27-18)19(25-29)24-13-5-8-16(21)15(20)11-13/h3-8,11H,9-10H2,1-2H3,(H4-,22,23,24,25,27,28,29,30,31,32)/p+1 |
| InChIKey | MXYIBAIEYVBBMR-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 174.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|