C13H15BrFN5O2S — CID 145042282
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 145042282) has the molecular formula C13H15BrFN5O2S and a molecular weight of 404.27 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 145042282 |
| Molecular Formula | C13H15BrFN5O2S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CSCCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H15BrFN5O2S/c1-23-6-2-5-16-12-11(19-22-20-12)13(18-21)17-8-3-4-10(15)9(14)7-8/h3-4,7,21H,2,5-6H2,1H3,(H,16,20)(H,17,18) |
| InChIKey | OMMGLDHLXOFARA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|