C17H21BrFN5O3S — CID 130255387
[[N-(3-bromo-4-fluorophenyl)-C-[4-(2-methylsulfanylethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2-dimethylpropanoate (PubChem CID 130255387) has the molecular formula C17H21BrFN5O3S and a molecular weight of 474.36 g/mol. Its IUPAC name is [[N-(3-bromo-4-fluorophenyl)-C-[4-(2-methylsulfanylethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2-dimethylpropanoate.
| Compound Name | [[N-(3-bromo-4-fluorophenyl)-C-[4-(2-methylsulfanylethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130255387 |
| Molecular Formula | C17H21BrFN5O3S |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | [[N-(3-bromo-4-fluorophenyl)-C-[4-(2-methylsulfanylethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2-dimethylpropanoate |
| SMILES | CSCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NOC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H21BrFN5O3S/c1-17(2,3)16(25)26-23-15(21-10-5-6-12(19)11(18)9-10)13-14(24-27-22-13)20-7-8-28-4/h5-6,9H,7-8H2,1-4H3,(H,20,24)(H,21,23) |
| InChIKey | HQBPQRGZPXFPAC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|