C18H20BrFN6O2S — CID 145364840
aniline;N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 145364840) has the molecular formula C18H20BrFN6O2S and a molecular weight of 483.37 g/mol. Its IUPAC name is aniline;N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | aniline;N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 145364840 |
| Molecular Formula | C18H20BrFN6O2S |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | aniline;N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CSCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO.Nc1ccccc1 |
| InChI | InChI=1S/C12H13BrFN5O2S.C6H7N/c1-22-5-4-15-11-10(18-21-19-11)12(17-20)16-7-2-3-9(14)8(13)6-7;7-6-4-2-1-3-5-6/h2-3,6,20H,4-5H2,1H3,(H,15,19)(H,16,17);1-5H,7H2 |
| InChIKey | CBSUNGRWHZTKFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|