C18H18BrFN6O2 — CID 136600077
4-[[benzyl(methyl)amino]methylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 136600077) has the molecular formula C18H18BrFN6O2 and a molecular weight of 449.28 g/mol. Its IUPAC name is 4-[[benzyl(methyl)amino]methylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[[benzyl(methyl)amino]methylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 136600077 |
| Molecular Formula | C18H18BrFN6O2 |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 4-[[benzyl(methyl)amino]methylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CN(CNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)Cc1ccccc1 |
| InChI | InChI=1S/C18H18BrFN6O2/c1-26(10-12-5-3-2-4-6-12)11-21-17-16(24-28-25-17)18(23-27)22-13-7-8-15(20)14(19)9-13/h2-9,27H,10-11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | NAQXMRSFZCYIKZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|