C16H21BrFN7O4S — CID 162644306
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[(1R,3R)-3-(sulfamoylamino)cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 162644306) has the molecular formula C16H21BrFN7O4S and a molecular weight of 506.36 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[(1R,3R)-3-(sulfamoylamino)cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[(1R,3R)-3-(sulfamoylamino)cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 162644306 |
| Molecular Formula | C16H21BrFN7O4S |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[[(1R,3R)-3-(sulfamoylamino)cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)N[C@@H]1CCC[C@@H](CNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)C1 |
| InChI | InChI=1S/C16H21BrFN7O4S/c17-12-7-10(4-5-13(12)18)21-16(22-26)14-15(24-29-23-14)20-8-9-2-1-3-11(6-9)25-30(19,27)28/h4-5,7,9,11,25-26H,1-3,6,8H2,(H,20,24)(H,21,22)(H2,19,27,28)/t9-,11-/m1/s1 |
| InChIKey | XNXRIEPYYJMBHW-MWLCHTKSSA-N |
| XLogP | 1.79 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|