C14H22BrFN6O2S — CID 145385736
bromomethane;N'-(4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide;methanamine (PubChem CID 145385736) has the molecular formula C14H22BrFN6O2S and a molecular weight of 437.34 g/mol. Its IUPAC name is bromomethane;N'-(4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide;methanamine.
| Compound Name | bromomethane;N'-(4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide;methanamine |
|---|---|
| PubChem CID | 145385736 |
| Molecular Formula | C14H22BrFN6O2S |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | bromomethane;N'-(4-fluorophenyl)-N-hydroxy-4-(2-methylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide;methanamine |
| SMILES | CBr.CN.CSCCNc1nonc1/C(=N/c1ccc(F)cc1)NO |
| InChI | InChI=1S/C12H14FN5O2S.CH3Br.CH5N/c1-21-7-6-14-11-10(17-20-18-11)12(16-19)15-9-4-2-8(13)3-5-9;2*1-2/h2-5,19H,6-7H2,1H3,(H,14,18)(H,15,16);1H3;2H2,1H3 |
| InChIKey | WWZISQMAWJNGRZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|