C15H17FN8O3 — CID 150754981
N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(1-hydroxyethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 150754981) has the molecular formula C15H17FN8O3 and a molecular weight of 376.35 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(1-hydroxyethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(1-hydroxyethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 150754981 |
| Molecular Formula | C15H17FN8O3 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(1-hydroxyethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(O)c1cn(CCNc2nonc2/C(=N/c2ccc(F)cc2)NO)nn1 |
| InChI | InChI=1S/C15H17FN8O3/c1-9(25)12-8-24(23-19-12)7-6-17-14-13(21-27-22-14)15(20-26)18-11-4-2-10(16)3-5-11/h2-5,8-9,25-26H,6-7H2,1H3,(H,17,22)(H,18,20) |
| InChIKey | JWQVPCPJLXBFIS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 146.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|