C16H19FN8O4 — CID 151884360
N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(2-hydroxyethoxymethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 151884360) has the molecular formula C16H19FN8O4 and a molecular weight of 406.38 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(2-hydroxyethoxymethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(2-hydroxyethoxymethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 151884360 |
| Molecular Formula | C16H19FN8O4 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N'-(4-fluorophenyl)-N-hydroxy-4-[2-[4-(2-hydroxyethoxymethyl)triazol-1-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | OCCOCc1cn(CCNc2nonc2/C(=N/c2ccc(F)cc2)NO)nn1 |
| InChI | InChI=1S/C16H19FN8O4/c17-11-1-3-12(4-2-11)19-16(21-27)14-15(23-29-22-14)18-5-6-25-9-13(20-24-25)10-28-8-7-26/h1-4,9,26-27H,5-8,10H2,(H,18,23)(H,19,21) |
| InChIKey | SPJUSECQVWLGOJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|