C13H16ClFN6O2S — CID 137306227
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(methylaminosulfanyl)propylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137306227) has the molecular formula C13H16ClFN6O2S and a molecular weight of 374.83 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(methylaminosulfanyl)propylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(methylaminosulfanyl)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137306227 |
| Molecular Formula | C13H16ClFN6O2S |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-(methylaminosulfanyl)propylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CNSCCCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C13H16ClFN6O2S/c1-16-24-6-2-5-17-12-11(20-23-21-12)13(19-22)18-8-3-4-10(15)9(14)7-8/h3-4,7,16,22H,2,5-6H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | KCRJXKMMBUBWRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|