C12H13ClFN5O3S2 — CID 145335270
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfinamido)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 145335270) has the molecular formula C12H13ClFN5O3S2 and a molecular weight of 393.85 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfinamido)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfinamido)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 145335270 |
| Molecular Formula | C12H13ClFN5O3S2 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfinamido)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)NCCSc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C12H13ClFN5O3S2/c1-24(21)15-4-5-23-12-10(18-22-19-12)11(17-20)16-7-2-3-9(14)8(13)6-7/h2-3,6,15,20H,4-5H2,1H3,(H,16,17) |
| InChIKey | JVZZBPAUBGBJCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|