C13H17FN6O4S2 — CID 157380207
N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(methylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 157380207) has the molecular formula C13H17FN6O4S2 and a molecular weight of 404.45 g/mol. Its IUPAC name is N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(methylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(methylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 157380207 |
| Molecular Formula | C13H17FN6O4S2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(methylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CNS(=O)(=O)NCCSc1nonc1/C(=N/c1ccc(F)c(C)c1)NO |
| InChI | InChI=1S/C13H17FN6O4S2/c1-8-7-9(3-4-10(8)14)17-12(18-21)11-13(20-24-19-11)25-6-5-16-26(22,23)15-2/h3-4,7,15-16,21H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | VNSKXGWZIYFGTC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|