C13H12BrFN4O3S — CID 159553360
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxobutylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159553360) has the molecular formula C13H12BrFN4O3S and a molecular weight of 403.23 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxobutylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxobutylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159553360 |
| Molecular Formula | C13H12BrFN4O3S |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxobutylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCC(=O)CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H12BrFN4O3S/c1-2-8(20)6-23-13-11(18-22-19-13)12(17-21)16-7-3-4-10(15)9(14)5-7/h3-5,21H,2,6H2,1H3,(H,16,17) |
| InChIKey | MFRIOGSOWXSPTM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|