C14H15BrFN5O5S — CID 137359784
2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-(2,3-dihydroxypropyl)acetamide (PubChem CID 137359784) has the molecular formula C14H15BrFN5O5S and a molecular weight of 464.27 g/mol. Its IUPAC name is 2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-(2,3-dihydroxypropyl)acetamide.
| Compound Name | 2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-(2,3-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 137359784 |
| Molecular Formula | C14H15BrFN5O5S |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-(2,3-dihydroxypropyl)acetamide |
| SMILES | O=C(CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)NCC(O)CO |
| InChI | InChI=1S/C14H15BrFN5O5S/c15-9-3-7(1-2-10(9)16)18-13(19-25)12-14(21-26-20-12)27-6-11(24)17-4-8(23)5-22/h1-3,8,22-23,25H,4-6H2,(H,17,24)(H,18,19) |
| InChIKey | DPAXUPOMQJRORK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|