C12H14BrFN6O5S2 — CID 137360232
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(sulfamoylamino)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137360232) has the molecular formula C12H14BrFN6O5S2 and a molecular weight of 485.32 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(sulfamoylamino)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(sulfamoylamino)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137360232 |
| Molecular Formula | C12H14BrFN6O5S2 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(sulfamoylamino)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NC(CO)CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H14BrFN6O5S2/c13-8-3-6(1-2-9(8)14)16-11(17-22)10-12(19-25-18-10)26-5-7(4-21)20-27(15,23)24/h1-3,7,20-22H,4-5H2,(H,16,17)(H2,15,23,24) |
| InChIKey | UDZXIPSQVFIXJD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 175.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|