C13H14Cl2FN5O4S — CID 137359768
methyl (2R)-2-amino-3-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoate;hydrochloride (PubChem CID 137359768) has the molecular formula C13H14Cl2FN5O4S and a molecular weight of 426.26 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoate;hydrochloride.
| Compound Name | methyl (2R)-2-amino-3-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 137359768 |
| Molecular Formula | C13H14Cl2FN5O4S |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | methyl (2R)-2-amino-3-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)CSc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO.Cl |
| InChI | InChI=1S/C13H13ClFN5O4S.ClH/c1-23-13(21)9(16)5-25-12-10(19-24-20-12)11(18-22)17-6-2-3-8(15)7(14)4-6;/h2-4,9,22H,5,16H2,1H3,(H,17,18);1H/t9-;/m0./s1 |
| InChIKey | DPXDNMIRUFRQKJ-FVGYRXGTSA-N |
| XLogP | 1.93 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|