C12H13ClFN5O3 — CID 139507149
4-(1-aminopropan-2-yloxy)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139507149) has the molecular formula C12H13ClFN5O3 and a molecular weight of 329.72 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yloxy)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(1-aminopropan-2-yloxy)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139507149 |
| Molecular Formula | C12H13ClFN5O3 |
| Molecular Weight | 329.72 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(1-aminopropan-2-yloxy)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(CN)Oc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C12H13ClFN5O3/c1-6(5-15)21-12-10(18-22-19-12)11(17-20)16-7-2-3-9(14)8(13)4-7/h2-4,6,20H,5,15H2,1H3,(H,16,17) |
| InChIKey | ZFWSWPIOVSSDSI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|