C9H7BrFN5O3 — CID 138737795
4-aminooxy-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138737795) has the molecular formula C9H7BrFN5O3 and a molecular weight of 332.09 g/mol. Its IUPAC name is 4-aminooxy-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-aminooxy-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138737795 |
| Molecular Formula | C9H7BrFN5O3 |
| Molecular Weight | 332.09 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 4-aminooxy-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NOc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C9H7BrFN5O3/c10-5-3-4(1-2-6(5)11)13-8(14-17)7-9(18-12)16-19-15-7/h1-3,17H,12H2,(H,13,14) |
| InChIKey | XFGSXQYRUQIZNH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.09 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|