C15H16BrFN4O2S — CID 138737781
N'-(3-bromo-4-fluorophenyl)-4-cyclohexylsulfanyl-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138737781) has the molecular formula C15H16BrFN4O2S and a molecular weight of 415.29 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-cyclohexylsulfanyl-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-cyclohexylsulfanyl-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138737781 |
| Molecular Formula | C15H16BrFN4O2S |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-cyclohexylsulfanyl-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Br)c1)c1nonc1SC1CCCCC1 |
| InChI | InChI=1S/C15H16BrFN4O2S/c16-11-8-9(6-7-12(11)17)18-14(19-22)13-15(21-23-20-13)24-10-4-2-1-3-5-10/h6-8,10,22H,1-5H2,(H,18,19) |
| InChIKey | JYFOHCOBDMHRJN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|