C15H17BrFN5O3 — CID 137462278
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[(4-hydroxycyclohexyl)amino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137462278) has the molecular formula C15H17BrFN5O3 and a molecular weight of 414.24 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[(4-hydroxycyclohexyl)amino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[(4-hydroxycyclohexyl)amino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137462278 |
| Molecular Formula | C15H17BrFN5O3 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[(4-hydroxycyclohexyl)amino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Br)c1)c1nonc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H17BrFN5O3/c16-11-7-9(3-6-12(11)17)19-14(20-24)13-15(22-25-21-13)18-8-1-4-10(23)5-2-8/h3,6-8,10,23-24H,1-2,4-5H2,(H,18,22)(H,19,20) |
| InChIKey | JRNDYKSGPPKFCW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|