C16H18ClFN6O4 — CID 137280188
1-[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 137280188) has the molecular formula C16H18ClFN6O4 and a molecular weight of 412.81 g/mol. Its IUPAC name is 1-[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 137280188 |
| Molecular Formula | C16H18ClFN6O4 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H18ClFN6O4/c17-11-7-9(3-6-12(11)18)19-14(22-27)13-15(24-28-23-13)21-16(26)20-8-1-4-10(25)5-2-8/h3,6-8,10,25,27H,1-2,4-5H2,(H,19,22)(H2,20,21,24,26) |
| InChIKey | WSXKETIAQACPAI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|