C17H19ClFN5O3 — CID 137280192
1-[3-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2-oxazol-4-yl]-3-cyclohexylurea (PubChem CID 137280192) has the molecular formula C17H19ClFN5O3 and a molecular weight of 395.82 g/mol. Its IUPAC name is 1-[3-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2-oxazol-4-yl]-3-cyclohexylurea.
| Compound Name | 1-[3-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2-oxazol-4-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 137280192 |
| Molecular Formula | C17H19ClFN5O3 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[3-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2-oxazol-4-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1conc1/C(=N/c1ccc(F)c(Cl)c1)NO)NC1CCCCC1 |
| InChI | InChI=1S/C17H19ClFN5O3/c18-12-8-11(6-7-13(12)19)20-16(23-26)15-14(9-27-24-15)22-17(25)21-10-4-2-1-3-5-10/h6-10,26H,1-5H2,(H,20,23)(H2,21,22,25) |
| InChIKey | ADQAKIDEFVWWJB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|