C13H13ClFN5O4 — CID 139507073
4-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]butanamide (PubChem CID 139507073) has the molecular formula C13H13ClFN5O4 and a molecular weight of 357.73 g/mol. Its IUPAC name is 4-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]butanamide.
| Compound Name | 4-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]butanamide |
|---|---|
| PubChem CID | 139507073 |
| Molecular Formula | C13H13ClFN5O4 |
| Molecular Weight | 357.73 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]butanamide |
| SMILES | NC(=O)CCCOc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C13H13ClFN5O4/c14-8-6-7(3-4-9(8)15)17-12(18-22)11-13(20-24-19-11)23-5-1-2-10(16)21/h3-4,6,22H,1-2,5H2,(H2,16,21)(H,17,18) |
| InChIKey | FEFSIAYUSMDVMQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.73 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|