C16H14ClFN6O5S — CID 139520814
N-[2-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 139520814) has the molecular formula C16H14ClFN6O5S and a molecular weight of 456.84 g/mol. Its IUPAC name is N-[2-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-[2-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 139520814 |
| Molecular Formula | C16H14ClFN6O5S |
| Molecular Weight | 456.84 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[2-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1OCCNC(=O)CC1SC(=O)NC1=O |
| InChI | InChI=1S/C16H14ClFN6O5S/c17-8-5-7(1-2-9(8)18)21-13(19)12-15(24-29-23-12)28-4-3-20-11(25)6-10-14(26)22-16(27)30-10/h1-2,5,10H,3-4,6H2,(H2,19,21)(H,20,25)(H,22,26,27) |
| InChIKey | RWNDZKZLXIDUSR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.84 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|