C20H16ClFN4O6 — CID 158352743
4-[2-[[4-[C-[(3-chloro-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylcarbamoyl]benzoic acid (PubChem CID 158352743) has the molecular formula C20H16ClFN4O6 and a molecular weight of 462.82 g/mol. Its IUPAC name is 4-[2-[[4-[C-[(3-chloro-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylcarbamoyl]benzoic acid.
| Compound Name | 4-[2-[[4-[C-[(3-chloro-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 158352743 |
| Molecular Formula | C20H16ClFN4O6 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[2-[[4-[C-[(3-chloro-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)NCCOc2nonc2C(Cc2ccc(F)c(Cl)c2)=NO)cc1 |
| InChI | InChI=1S/C20H16ClFN4O6/c21-14-9-11(1-6-15(14)22)10-16(24-30)17-19(26-32-25-17)31-8-7-23-18(27)12-2-4-13(5-3-12)20(28)29/h1-6,9,30H,7-8,10H2,(H,23,27)(H,28,29) |
| InChIKey | GSMZRLHAVXUDMD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|