C16H16ClFN6O2 — CID 157159810
N-[2-(3-chloro-4-fluorophenyl)-1-[4-[[2-(1H-imidazol-5-yl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine (PubChem CID 157159810) has the molecular formula C16H16ClFN6O2 and a molecular weight of 378.80 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluorophenyl)-1-[4-[[2-(1H-imidazol-5-yl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine.
| Compound Name | N-[2-(3-chloro-4-fluorophenyl)-1-[4-[[2-(1H-imidazol-5-yl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 157159810 |
| Molecular Formula | C16H16ClFN6O2 |
| Molecular Weight | 378.80 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[2-(3-chloro-4-fluorophenyl)-1-[4-[[2-(1H-imidazol-5-yl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine |
| SMILES | ON=C(Cc1ccc(F)c(Cl)c1)c1nonc1CNCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H16ClFN6O2/c17-12-5-10(1-2-13(12)18)6-14(22-25)16-15(23-26-24-16)8-19-4-3-11-7-20-9-21-11/h1-2,5,7,9,19,25H,3-4,6,8H2,(H,20,21) |
| InChIKey | AMFUSETUMKASIL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.80 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|