C12H13ClFN5O2 — CID 89342628
N'-(3-chloro-4-fluorophenyl)-4-[(2-hydroxyethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342628) has the molecular formula C12H13ClFN5O2 and a molecular weight of 313.72 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[(2-hydroxyethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[(2-hydroxyethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342628 |
| Molecular Formula | C12H13ClFN5O2 |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[(2-hydroxyethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1CNCCO |
| InChI | InChI=1S/C12H13ClFN5O2/c13-8-5-7(1-2-9(8)14)17-12(15)11-10(18-21-19-11)6-16-3-4-20/h1-2,5,16,20H,3-4,6H2,(H2,15,17) |
| InChIKey | OGOSUBUZZKEGMJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|