C37H32ClFN6O7 — CID 89342668
5-[6-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]methylamino]hexylcarbamoyl]-2-(2-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 89342668) has the molecular formula C37H32ClFN6O7 and a molecular weight of 727.15 g/mol. Its IUPAC name is 5-[6-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]methylamino]hexylcarbamoyl]-2-(2-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[6-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]methylamino]hexylcarbamoyl]-2-(2-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89342668 |
| Molecular Formula | C37H32ClFN6O7 |
| Molecular Weight | 727.15 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 5-[6-[[4-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]methylamino]hexylcarbamoyl]-2-(2-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1CNCCCCCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3ccc(O)cc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C37H32ClFN6O7/c38-28-16-21(6-11-29(28)39)43-35(40)34-30(44-52-45-34)19-41-13-3-1-2-4-14-42-36(48)20-5-9-24(26(15-20)37(49)50)33-25-10-7-23(47)18-32(25)51-31-12-8-22(46)17-27(31)33/h5-12,15-18,41,46H,1-4,13-14,19H2,(H2,40,43)(H,42,48)(H,49,50) |
| InChIKey | OQIYSYOUSSGEON-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 206.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.15 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|