C45H30Cl2N4O10 — CID 89386259
2-(3-amino-6-methyliminoxanthen-9-yl)-5-[2-[[3-carboxy-4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethylcarbamoyl]-3,6-dichlorobenzoic acid (PubChem CID 89386259) has the molecular formula C45H30Cl2N4O10 and a molecular weight of 857.66 g/mol. Its IUPAC name is 2-(3-amino-6-methyliminoxanthen-9-yl)-5-[2-[[3-carboxy-4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethylcarbamoyl]-3,6-dichlorobenzoic acid.
| Compound Name | 2-(3-amino-6-methyliminoxanthen-9-yl)-5-[2-[[3-carboxy-4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethylcarbamoyl]-3,6-dichlorobenzoic acid |
|---|---|
| PubChem CID | 89386259 |
| Molecular Formula | C45H30Cl2N4O10 |
| Molecular Weight | 857.66 g/mol |
| Exact Mass | 856.13 |
| IUPAC Name | 2-(3-amino-6-methyliminoxanthen-9-yl)-5-[2-[[3-carboxy-4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]ethylcarbamoyl]-3,6-dichlorobenzoic acid |
| SMILES | C/N=c1\ccc2c(-c3c(Cl)cc(C(=O)NCCNC(=O)c4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)c(C(=O)O)c4)c(Cl)c3C(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C45H30Cl2N4O10/c1-49-22-4-9-29-34(16-22)60-33-15-21(48)3-8-28(33)38(29)39-32(46)19-31(41(47)40(39)45(58)59)43(55)51-13-12-50-42(54)20-2-7-25(30(14-20)44(56)57)37-26-10-5-23(52)17-35(26)61-36-18-24(53)6-11-27(36)37/h2-11,14-19,52H,12-13,48H2,1H3,(H,50,54)(H,51,55)(H,56,57)(H,58,59)/b49-22+ |
| InChIKey | NWRWBSUDQXKQTR-QBXYCMTPSA-N |
| XLogP | 7.76 |
| TPSA | 234.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.66 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|