C41H26Cl2N3O7+ — CID 59180824
[6-amino-9-[2-carboxy-3,6-dichloro-5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylcarbamoyl]phenyl]xanthen-3-ylidene]azanium (PubChem CID 59180824) has the molecular formula C41H26Cl2N3O7+ and a molecular weight of 743.58 g/mol. Its IUPAC name is [6-amino-9-[2-carboxy-3,6-dichloro-5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylcarbamoyl]phenyl]xanthen-3-ylidene]azanium.
| Compound Name | [6-amino-9-[2-carboxy-3,6-dichloro-5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylcarbamoyl]phenyl]xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 59180824 |
| Molecular Formula | C41H26Cl2N3O7+ |
| Molecular Weight | 743.58 g/mol |
| Exact Mass | 742.11 |
| IUPAC Name | [6-amino-9-[2-carboxy-3,6-dichloro-5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylcarbamoyl]phenyl]xanthen-3-ylidene]azanium |
| SMILES | Nc1ccc2c(-c3c(Cl)c(C(=O)NCc4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)cc4)cc(Cl)c3C(=O)O)c3ccc(=[NH2+])cc-3oc2c1 |
| InChI | InChI=1S/C41H25Cl2N3O7/c42-30-17-29(39(43)38(37(30)41(50)51)36-27-9-5-21(44)13-31(27)52-32-14-22(45)6-10-28(32)36)40(49)46-18-19-1-3-20(4-2-19)35-25-11-7-23(47)15-33(25)53-34-16-24(48)8-12-26(34)35/h1-17,44,47H,18,45H2,(H,46,49)(H,50,51)/p+1 |
| InChIKey | IYOXHAYSEVIVQP-UHFFFAOYSA-O |
| XLogP | 6.97 |
| TPSA | 181.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|