C47H36Cl2N4O8 — CID 59180810
3,6-dichloro-2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid (PubChem CID 59180810) has the molecular formula C47H36Cl2N4O8 and a molecular weight of 855.73 g/mol. Its IUPAC name is 3,6-dichloro-2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid.
| Compound Name | 3,6-dichloro-2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59180810 |
| Molecular Formula | C47H36Cl2N4O8 |
| Molecular Weight | 855.73 g/mol |
| Exact Mass | 854.19 |
| IUPAC Name | 3,6-dichloro-2-[3-(ethylamino)-6-ethyliminoxanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid |
| SMILES | CC/N=c1\ccc2c(-c3c(Cl)c(C(=O)NCC(=O)NCc4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)cc4)cc(Cl)c3C(=O)O)c3ccc(NCC)cc3oc-2c1 |
| InChI | InChI=1S/C47H36Cl2N4O8/c1-3-50-26-9-13-32-36(17-26)60-37-18-27(51-4-2)10-14-33(37)42(32)44-43(47(58)59)35(48)21-34(45(44)49)46(57)53-23-40(56)52-22-24-5-7-25(8-6-24)41-30-15-11-28(54)19-38(30)61-39-20-29(55)12-16-31(39)41/h5-21,50,54H,3-4,22-23H2,1-2H3,(H,52,56)(H,53,57)(H,58,59)/b51-27+ |
| InChIKey | RKTJXRLHCPCDNL-UCXVKNHOSA-N |
| XLogP | 9.19 |
| TPSA | 183.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.73 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|