C46H33Cl2N3O8 — CID 88588819
3,6-dichloro-2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid (PubChem CID 88588819) has the molecular formula C46H33Cl2N3O8 and a molecular weight of 826.69 g/mol. Its IUPAC name is 3,6-dichloro-2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid.
| Compound Name | 3,6-dichloro-2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88588819 |
| Molecular Formula | C46H33Cl2N3O8 |
| Molecular Weight | 826.69 g/mol |
| Exact Mass | 825.16 |
| IUPAC Name | 3,6-dichloro-2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-4-[[2-[[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]methylamino]-2-oxoethyl]carbamoyl]benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(C)C)ccc1C=2c1c(Cl)c(C(=O)NCC(=O)NCc2ccc(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)cc2)cc(Cl)c1C(=O)O |
| InChI | InChI=1S/C46H33Cl2N3O8/c1-23-4-12-31-35(16-23)58-36-17-26(51(2)3)9-13-32(36)41(31)43-42(46(56)57)34(47)20-33(44(43)48)45(55)50-22-39(54)49-21-24-5-7-25(8-6-24)40-29-14-10-27(52)18-37(29)59-38-19-28(53)11-15-30(38)40/h4-20,52H,1,21-22H2,2-3H3,(H,49,54)(H,50,55)(H,56,57) |
| InChIKey | GJYCFGAMJICHHM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.69 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|