C51H41N3O11 — CID 20755942
5-[[5-carboxy-5-[[3-carboxy-4-[3-(dimethylamino)-6-methylidenexanthen-9-yl]benzoyl]amino]pentyl]carbamoyl]-2-(3-oxoxanthen-9-yl)benzoic acid (PubChem CID 20755942) has the molecular formula C51H41N3O11 and a molecular weight of 871.90 g/mol. Its IUPAC name is 5-[[5-carboxy-5-[[3-carboxy-4-[3-(dimethylamino)-6-methylidenexanthen-9-yl]benzoyl]amino]pentyl]carbamoyl]-2-(3-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[5-carboxy-5-[[3-carboxy-4-[3-(dimethylamino)-6-methylidenexanthen-9-yl]benzoyl]amino]pentyl]carbamoyl]-2-(3-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 20755942 |
| Molecular Formula | C51H41N3O11 |
| Molecular Weight | 871.90 g/mol |
| Exact Mass | 871.27 |
| IUPAC Name | 5-[[5-carboxy-5-[[3-carboxy-4-[3-(dimethylamino)-6-methylidenexanthen-9-yl]benzoyl]amino]pentyl]carbamoyl]-2-(3-oxoxanthen-9-yl)benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(C)C)ccc1C=2c1ccc(C(=O)NC(CCCCNC(=O)c2ccc(-c3c4ccc(=O)cc-4oc4ccccc34)c(C(=O)O)c2)C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C51H41N3O11/c1-27-11-16-35-42(22-27)65-43-25-30(54(2)3)14-19-36(43)46(35)33-18-13-29(24-39(33)50(60)61)48(57)53-40(51(62)63)9-6-7-21-52-47(56)28-12-17-32(38(23-28)49(58)59)45-34-8-4-5-10-41(34)64-44-26-31(55)15-20-37(44)45/h4-5,8,10-20,22-26,40H,1,6-7,9,21H2,2-3H3,(H,52,56)(H,53,57)(H,58,59)(H,60,61)(H,62,63) |
| InChIKey | GNCIJASORJCFPU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.90 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|