C31H27N3O6 — CID 121361236
2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-5-[3-(2,5-dioxopyrrol-1-yl)propylcarbamoyl]benzoic acid (PubChem CID 121361236) has the molecular formula C31H27N3O6 and a molecular weight of 537.57 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-5-[3-(2,5-dioxopyrrol-1-yl)propylcarbamoyl]benzoic acid.
| Compound Name | 2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-5-[3-(2,5-dioxopyrrol-1-yl)propylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 121361236 |
| Molecular Formula | C31H27N3O6 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-[3-(dimethylamino)-6-methylidenexanthen-9-yl]-5-[3-(2,5-dioxopyrrol-1-yl)propylcarbamoyl]benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(C)C)ccc1C=2c1ccc(C(=O)NCCCN2C(=O)C=CC2=O)cc1C(=O)O |
| InChI | InChI=1S/C31H27N3O6/c1-18-5-8-22-25(15-18)40-26-17-20(33(2)3)7-10-23(26)29(22)21-9-6-19(16-24(21)31(38)39)30(37)32-13-4-14-34-27(35)11-12-28(34)36/h5-12,15-17H,1,4,13-14H2,2-3H3,(H,32,37)(H,38,39) |
| InChIKey | QVIWADPXPIJLIA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|