C35H38N4O8 — CID 156598947
2-[3-(dimethylamino)-6-(dimethylazaniumyl)-9H-xanthen-9-yl]-5-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylcarbamoyl]benzoate (PubChem CID 156598947) has the molecular formula C35H38N4O8 and a molecular weight of 642.71 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-(dimethylazaniumyl)-9H-xanthen-9-yl]-5-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylcarbamoyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-(dimethylazaniumyl)-9H-xanthen-9-yl]-5-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 156598947 |
| Molecular Formula | C35H38N4O8 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 2-[3-(dimethylamino)-6-(dimethylazaniumyl)-9H-xanthen-9-yl]-5-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylcarbamoyl]benzoate |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc([NH+](C)C)ccc1C2c1ccc(C(=O)NCCOCCOCCN2C(=O)C=CC2=O)cc1C(=O)[O-] |
| InChI | InChI=1S/C35H38N4O8/c1-37(2)23-6-9-26-29(20-23)47-30-21-24(38(3)4)7-10-27(30)33(26)25-8-5-22(19-28(25)35(43)44)34(42)36-13-15-45-17-18-46-16-14-39-31(40)11-12-32(39)41/h5-12,19-21,33H,13-18H2,1-4H3,(H,36,42)(H,43,44) |
| InChIKey | ZHKGXRKRYSBHJU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|