C15H23NO7 — CID 177233739
1-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 177233739) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177233739 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | CC(=O)COCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23NO7/c1-13(17)12-23-11-10-22-9-8-21-7-6-20-5-4-16-14(18)2-3-15(16)19/h2-3H,4-12H2,1H3 |
| InChIKey | OWJYKQIAWCUEPA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|