C20H33NO9 — CID 139443419
1-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 139443419) has the molecular formula C20H33NO9 and a molecular weight of 431.48 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139443419 |
| Molecular Formula | C20H33NO9 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | CC(=O)CCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H33NO9/c1-18(22)4-6-25-8-10-27-12-14-29-16-17-30-15-13-28-11-9-26-7-5-21-19(23)2-3-20(21)24/h2-3H,4-17H2,1H3 |
| InChIKey | UOJGFFOHSZLXED-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|