C11H21NO4 — CID 158080299
methane;1-[2-(2-methoxyethoxy)ethyl]pyrrole-2,5-dione (PubChem CID 158080299) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is methane;1-[2-(2-methoxyethoxy)ethyl]pyrrole-2,5-dione.
| Compound Name | methane;1-[2-(2-methoxyethoxy)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158080299 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | methane;1-[2-(2-methoxyethoxy)ethyl]pyrrole-2,5-dione |
| SMILES | C.C.COCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13NO4.2CH4/c1-13-6-7-14-5-4-10-8(11)2-3-9(10)12;;/h2-3H,4-7H2,1H3;2*1H4 |
| InChIKey | FMWJMUCSHPLBIX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|