C12H19NO5S — CID 132917103
1-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 132917103) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 132917103 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCOCCOCCOCCS |
| InChI | InChI=1S/C12H19NO5S/c14-11-1-2-12(15)13(11)3-4-16-5-6-17-7-8-18-9-10-19/h1-2,19H,3-10H2 |
| InChIKey | YNRBIPGXPOVLAB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|